C19H22ClN3O5 — CID 55364467
N-[4-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 55364467) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is N-[4-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55364467 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[4-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)CCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C19H22ClN3O5/c1-23(12-17(24)22-14-11-13(20)7-8-15(14)27-2)18(25)6-3-9-21-19(26)16-5-4-10-28-16/h4-5,7-8,10-11H,3,6,9,12H2,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | MCAHKQGGVNMMEN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|