C23H18ClN3O7 — CID 55366052
N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 55366052) has the molecular formula C23H18ClN3O7 and a molecular weight of 483.86 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 55366052 |
| Molecular Formula | C23H18ClN3O7 |
| Molecular Weight | 483.86 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | CCOc1ccc(Oc2ccc(Cl)cc2NC(=O)Cn2c(=O)oc3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C23H18ClN3O7/c1-2-32-16-5-7-17(8-6-16)33-20-10-3-14(24)11-18(20)25-22(28)13-26-19-9-4-15(27(30)31)12-21(19)34-23(26)29/h3-12H,2,13H2,1H3,(H,25,28) |
| InChIKey | VQAAPWDWASPYKE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.86 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|