C25H21ClN2O4 — CID 60586135
N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(4-oxoquinolin-1-yl)acetamide (PubChem CID 60586135) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(4-oxoquinolin-1-yl)acetamide.
| Compound Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(4-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 60586135 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-2-(4-oxoquinolin-1-yl)acetamide |
| SMILES | CCOc1ccc(Oc2ccc(Cl)cc2NC(=O)Cn2ccc(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H21ClN2O4/c1-2-31-18-8-10-19(11-9-18)32-24-12-7-17(26)15-21(24)27-25(30)16-28-14-13-23(29)20-5-3-4-6-22(20)28/h3-15H,2,16H2,1H3,(H,27,30) |
| InChIKey | XVWQHZAOGBLORP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |