C23H24ClN3O6 — CID 55468975
2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide (PubChem CID 55468975) has the molecular formula C23H24ClN3O6 and a molecular weight of 473.91 g/mol. Its IUPAC name is 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide.
| Compound Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 55468975 |
| Molecular Formula | C23H24ClN3O6 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2cc(Cl)ccc2Oc2ccc(OCC)cc2)C1=O |
| InChI | InChI=1S/C23H24ClN3O6/c1-3-5-12-26-21(29)22(30)27(23(26)31)14-20(28)25-18-13-15(24)6-11-19(18)33-17-9-7-16(8-10-17)32-4-2/h6-11,13H,3-5,12,14H2,1-2H3,(H,25,28) |
| InChIKey | LIQMMLJLYUSJDZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|