C25H26N2O7S — CID 55369073
ethyl 2-[2-[4-(furan-2-carbonylamino)butanoyloxy]propanoylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 55369073) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is ethyl 2-[2-[4-(furan-2-carbonylamino)butanoyloxy]propanoylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[4-(furan-2-carbonylamino)butanoyloxy]propanoylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55369073 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | ethyl 2-[2-[4-(furan-2-carbonylamino)butanoyloxy]propanoylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)C(C)OC(=O)CCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C25H26N2O7S/c1-3-32-25(31)18-15-20(17-9-5-4-6-10-17)35-24(18)27-22(29)16(2)34-21(28)12-7-13-26-23(30)19-11-8-14-33-19/h4-6,8-11,14-16H,3,7,12-13H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | VODDBYDCZUVGNT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|