C19H20ClNO4S — CID 55371148
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(3-chlorophenoxy)propanoate (PubChem CID 55371148) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(3-chlorophenoxy)propanoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(3-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 55371148 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(3-chlorophenoxy)propanoate |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)OCC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C19H20ClNO4S/c1-13(25-15-6-2-5-14(20)11-15)19(23)24-12-18(22)21-9-3-7-16(21)17-8-4-10-26-17/h2,4-6,8,10-11,13,16H,3,7,9,12H2,1H3 |
| InChIKey | PVRJVTOCSYMBLG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |