C20H18F3NO3S — CID 55371263
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 55371263) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55371263 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)OCC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C20H18F3NO3S/c21-20(22,23)15-5-1-4-14(12-15)8-9-19(26)27-13-18(25)24-10-2-6-16(24)17-7-3-11-28-17/h1,3-5,7-9,11-12,16H,2,6,10,13H2/b9-8+ |
| InChIKey | KDTFFGYXFMBUHD-CMDGGOBGSA-N |
| XLogP | 4.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|