C25H28N2O4S — CID 55371333
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 55371333) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55371333 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCC1c1cccs1)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N2O4S/c28-23(11-10-19-6-2-1-3-7-19)26-15-12-20(13-16-26)25(30)31-18-24(29)27-14-4-8-21(27)22-9-5-17-32-22/h1-3,5-7,9-11,17,20-21H,4,8,12-16,18H2/b11-10+ |
| InChIKey | XCFVEFFMABKNLJ-ZHACJKMWSA-N |
| XLogP | 3.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|