C21H24N2O6S2 — CID 55371116
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 55371116) has the molecular formula C21H24N2O6S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55371116 |
| Molecular Formula | C21H24N2O6S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)OCC(=O)N2CCCC2c2cccs2)ccc1OC |
| InChI | InChI=1S/C21H24N2O6S2/c1-22-31(26,27)19-13-15(7-9-17(19)28-2)8-10-21(25)29-14-20(24)23-11-3-5-16(23)18-6-4-12-30-18/h4,6-10,12-13,16,22H,3,5,11,14H2,1-2H3/b10-8+ |
| InChIKey | OFNSUGAQUFUWBU-CSKARUKUSA-N |
| XLogP | 2.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|