C25H25N3O4S — CID 55371584
(E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[phenyl(pyridin-4-yl)methyl]prop-2-enamide (PubChem CID 55371584) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[phenyl(pyridin-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[phenyl(pyridin-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55371584 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[phenyl(pyridin-4-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)NC(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C25H25N3O4S/c29-24(27-25(21-4-2-1-3-5-21)22-12-14-26-15-13-22)11-8-20-6-9-23(10-7-20)33(30,31)28-16-18-32-19-17-28/h1-15,25H,16-19H2,(H,27,29)/b11-8+ |
| InChIKey | OHJAGQWVSSURQZ-DHZHZOJOSA-N |
| XLogP | 3.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|