C20H19N3O7 — CID 55371785
(3-methyl-4-nitrophenyl) 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 55371785) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is (3-methyl-4-nitrophenyl) 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (3-methyl-4-nitrophenyl) 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 55371785 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (3-methyl-4-nitrophenyl) 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)Oc3ccc([N+](=O)[O-])c(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O7/c1-12-10-15(8-9-16(12)23(27)28)30-17(24)11-22-18(25)20(2,21-19(22)26)13-4-6-14(29-3)7-5-13/h4-10H,11H2,1-3H3,(H,21,26) |
| InChIKey | RRNUBOZNYIUSEX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|