C22H21NO6S — CID 55372297
7-[2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 55372297) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 7-[2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 55372297 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 7-[2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | CCS(=O)(=O)N1CCc2cc(C(=O)COc3ccc4c(C)cc(=O)oc4c3)ccc21 |
| InChI | InChI=1S/C22H21NO6S/c1-3-30(26,27)23-9-8-15-11-16(4-7-19(15)23)20(24)13-28-17-5-6-18-14(2)10-22(25)29-21(18)12-17/h4-7,10-12H,3,8-9,13H2,1-2H3 |
| InChIKey | KSVFQDJCFJSXCC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|