C21H27N3O4S2 — CID 55375869
N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide (PubChem CID 55375869) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 55375869 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(NC(=O)CCC(=O)c3ccc(C)s3)cc2)CC1 |
| InChI | InChI=1S/C21H27N3O4S2/c1-3-23-12-14-24(15-13-23)30(27,28)18-7-5-17(6-8-18)22-21(26)11-9-19(25)20-10-4-16(2)29-20/h4-8,10H,3,9,11-15H2,1-2H3,(H,22,26) |
| InChIKey | WAWUUMSXMMZIAK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |