C18H28N4O5S2 — CID 55429567
N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 55429567) has the molecular formula C18H28N4O5S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55429567 |
| Molecular Formula | C18H28N4O5S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(NC(=O)C3CCCN3S(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O5S2/c1-3-20-11-13-21(14-12-20)29(26,27)16-8-6-15(7-9-16)19-18(23)17-5-4-10-22(17)28(2,24)25/h6-9,17H,3-5,10-14H2,1-2H3,(H,19,23) |
| InChIKey | PJTLREPQIJTKDL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |