C15H20ClN3O4S — CID 131893969
(2S)-N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 131893969) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is (2S)-N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131893969 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (2S)-N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(NC(=O)[C@@H]2CCCN2S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H20ClN3O4S/c1-3-17-14(20)11-9-10(6-7-12(11)16)18-15(21)13-5-4-8-19(13)24(2,22)23/h6-7,9,13H,3-5,8H2,1-2H3,(H,17,20)(H,18,21)/t13-/m0/s1 |
| InChIKey | AZRWKVVESQHVOM-ZDUSSCGKSA-N |
| XLogP | 1.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |