C21H18Cl2N2O4S — CID 55376093
4-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxy-2-phenylethyl)benzamide (PubChem CID 55376093) has the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.36 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxy-2-phenylethyl)benzamide.
| Compound Name | 4-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxy-2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 55376093 |
| Molecular Formula | C21H18Cl2N2O4S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxy-2-phenylethyl)benzamide |
| SMILES | O=C(NCC(O)c1ccccc1)c1ccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O4S/c22-16-8-11-18(23)20(12-16)30(28,29)25-17-9-6-15(7-10-17)21(27)24-13-19(26)14-4-2-1-3-5-14/h1-12,19,25-26H,13H2,(H,24,27) |
| InChIKey | WBSCADOYJIAEET-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |