C18H23N3O6S — CID 55378603
(5-methyl-2-oxooxolan-3-yl) 3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate (PubChem CID 55378603) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 55378603 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate |
| SMILES | CC1CC(OC(=O)CCc2nc3cc(S(=O)(=O)N(C)C)ccc3n2C)C(=O)O1 |
| InChI | InChI=1S/C18H23N3O6S/c1-11-9-15(18(23)26-11)27-17(22)8-7-16-19-13-10-12(28(24,25)20(2)3)5-6-14(13)21(16)4/h5-6,10-11,15H,7-9H2,1-4H3 |
| InChIKey | UDPDPCAOLOPTSI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |