C21H31N3O4S — CID 78770583
(3-methylcyclohexyl) 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate (PubChem CID 78770583) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is (3-methylcyclohexyl) 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate.
| Compound Name | (3-methylcyclohexyl) 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 78770583 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (3-methylcyclohexyl) 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate |
| SMILES | CCn1c(CCC(=O)OC2CCCC(C)C2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C21H31N3O4S/c1-5-24-19-10-9-17(29(26,27)23(3)4)14-18(19)22-20(24)11-12-21(25)28-16-8-6-7-15(2)13-16/h9-10,14-16H,5-8,11-13H2,1-4H3 |
| InChIKey | JDLFFRCZHKWVRK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |