C21H23ClN4O4S — CID 55379148
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55379148) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55379148 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)Cn2c(C)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C21H23ClN4O4S/c1-4-25(5-2)31(29,30)15-10-11-17(22)19(12-15)24-20(27)13-26-14(3)23-18-9-7-6-8-16(18)21(26)28/h6-12H,4-5,13H2,1-3H3,(H,24,27) |
| InChIKey | QAAHUSBDOHAUQV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |