C24H31N3O4 — CID 55380256
[2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 55380256) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is [2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 55380256 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | CC12CCC(C/C1=N/NC(=O)COC(=O)c1ccc(CN3CCCC3=O)cc1)C2(C)C |
| InChI | InChI=1S/C24H31N3O4/c1-23(2)18-10-11-24(23,3)19(13-18)25-26-20(28)15-31-22(30)17-8-6-16(7-9-17)14-27-12-4-5-21(27)29/h6-9,18H,4-5,10-15H2,1-3H3,(H,26,28)/b25-19- |
| InChIKey | OIGUIRXQNFIBGB-PLRJNAJWSA-N |
| XLogP | 3.28 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|