C19H23N3O2S — CID 55382202
N'-[2-(2,4-dimethylanilino)acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 55382202) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55382202 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2cc3c(s2)CCCC3)c(C)c1 |
| InChI | InChI=1S/C19H23N3O2S/c1-12-7-8-15(13(2)9-12)20-11-18(23)21-22-19(24)17-10-14-5-3-4-6-16(14)25-17/h7-10,20H,3-6,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | UKFNESQCCUTFSK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|