C25H25N3O4S — CID 55382337
N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide (PubChem CID 55382337) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide.
| Compound Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 55382337 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide |
| SMILES | CC(=O)NCCCc1ccc(-c2csc(NC(=O)C3(C)Cc4ccccc4C(=O)O3)n2)cc1 |
| InChI | InChI=1S/C25H25N3O4S/c1-16(29)26-13-5-6-17-9-11-18(12-10-17)21-15-33-24(27-21)28-23(31)25(2)14-19-7-3-4-8-20(19)22(30)32-25/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,26,29)(H,27,28,31) |
| InChIKey | XEKRKEIPAKVABK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|