C25H24N2O5S — CID 55383614
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 55383614) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55383614 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)c3cccc(S(=O)(=O)NC4CC4)c3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-17-6-8-18(9-7-17)24(28)27(2)21-12-14-22(15-13-21)32-25(29)19-4-3-5-23(16-19)33(30,31)26-20-10-11-20/h3-9,12-16,20,26H,10-11H2,1-2H3 |
| InChIKey | ZOSLAOFQNBWHOZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|