C26H22N2O6S — CID 55865780
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylate (PubChem CID 55865780) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 55865780 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)c3ccc4c(c3)S(=O)(=O)N(C3CC3)C4=O)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O6S/c1-16-3-5-17(6-4-16)24(29)27(2)19-10-12-21(13-11-19)34-26(31)18-7-14-22-23(15-18)35(32,33)28(25(22)30)20-8-9-20/h3-7,10-15,20H,8-9H2,1-2H3 |
| InChIKey | ZKRZPLYOSOKLHF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|