C23H18ClNO5 — CID 55383566
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 7-chloro-1,3-benzodioxole-5-carboxylate (PubChem CID 55383566) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 7-chloro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 7-chloro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 55383566 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 7-chloro-1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)c3cc(Cl)c4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C23H18ClNO5/c1-14-3-5-15(6-4-14)22(26)25(2)17-7-9-18(10-8-17)30-23(27)16-11-19(24)21-20(12-16)28-13-29-21/h3-12H,13H2,1-2H3 |
| InChIKey | FRZDHUQVDXRXFK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|