C22H20ClFN4O4S — CID 55384705
2-chloro-N-[1-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 55384705) has the molecular formula C22H20ClFN4O4S and a molecular weight of 490.94 g/mol. Its IUPAC name is 2-chloro-N-[1-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 55384705 |
| Molecular Formula | C22H20ClFN4O4S |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-chloro-N-[1-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)Nc1ncc(Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H20ClFN4O4S/c1-12(2)19(26-20(29)17-8-7-15(28(31)32)10-18(17)23)21(30)27-22-25-11-16(33-22)9-13-3-5-14(24)6-4-13/h3-8,10-12,19H,9H2,1-2H3,(H,26,29)(H,25,27,30) |
| InChIKey | WYEPSJPWZLKGPL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|