C22H21ClN4O4S — CID 112767234
N-[1-[(5-benzyl-1,3-thiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]-2-chloro-4-nitrobenzamide (PubChem CID 112767234) has the molecular formula C22H21ClN4O4S and a molecular weight of 472.95 g/mol. Its IUPAC name is N-[1-[(5-benzyl-1,3-thiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]-2-chloro-4-nitrobenzamide.
| Compound Name | N-[1-[(5-benzyl-1,3-thiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 112767234 |
| Molecular Formula | C22H21ClN4O4S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-[1-[(5-benzyl-1,3-thiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]-2-chloro-4-nitrobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H21ClN4O4S/c1-13(2)19(25-20(28)17-9-8-15(27(30)31)11-18(17)23)21(29)26-22-24-12-16(32-22)10-14-6-4-3-5-7-14/h3-9,11-13,19H,10H2,1-2H3,(H,25,28)(H,24,26,29) |
| InChIKey | GUUJGIUCAPPZNG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|