C24H27N3O4 — CID 55386829
N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbohydrazide (PubChem CID 55386829) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 55386829 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NNC(=O)COc3cc(C)ccc3C)c2C)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-15-6-7-16(2)22(12-15)31-14-23(28)25-26-24(29)21-13-17(3)27(18(21)4)19-8-10-20(30-5)11-9-19/h6-13H,14H2,1-5H3,(H,25,28)(H,26,29) |
| InChIKey | FMXVNEINCPTZST-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|