C16H14Cl2FNOS — CID 55386908
2,4-dichloro-5-fluoro-N-[2-(4-methylphenyl)sulfanylethyl]benzamide (PubChem CID 55386908) has the molecular formula C16H14Cl2FNOS and a molecular weight of 358.27 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[2-(4-methylphenyl)sulfanylethyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 55386908 |
| Molecular Formula | C16H14Cl2FNOS |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
| SMILES | Cc1ccc(SCCNC(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2FNOS/c1-10-2-4-11(5-3-10)22-7-6-20-16(21)12-8-15(19)14(18)9-13(12)17/h2-5,8-9H,6-7H2,1H3,(H,20,21) |
| InChIKey | KFYNDCIJRGCPJC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|