C21H18ClN5O3 — CID 55387231
N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine (PubChem CID 55387231) has the molecular formula C21H18ClN5O3 and a molecular weight of 423.86 g/mol. Its IUPAC name is N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine.
| Compound Name | N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 55387231 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| SMILES | CC(NCc1ccc(-c2ccc(Cl)cc2[N+](=O)[O-])o1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C21H18ClN5O3/c1-14(15-2-5-17(6-3-15)26-13-23-12-25-26)24-11-18-7-9-21(30-18)19-8-4-16(22)10-20(19)27(28)29/h2-10,12-14,24H,11H2,1H3 |
| InChIKey | CMYDHCAGYQIFHH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|