C25H30N2O3S — CID 55391334
N-(oxolan-2-ylmethyl)-1-[(E)-3-phenylprop-2-enoyl]-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 55391334) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-[(E)-3-phenylprop-2-enoyl]-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-[(E)-3-phenylprop-2-enoyl]-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55391334 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-[(E)-3-phenylprop-2-enoyl]-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(/C=C/c1ccccc1)N1CCC(C(=O)N(Cc2cccs2)CC2CCCO2)CC1 |
| InChI | InChI=1S/C25H30N2O3S/c28-24(11-10-20-6-2-1-3-7-20)26-14-12-21(13-15-26)25(29)27(18-22-8-4-16-30-22)19-23-9-5-17-31-23/h1-3,5-7,9-11,17,21-22H,4,8,12-16,18-19H2/b11-10+ |
| InChIKey | GFPYFCZRYLOCKO-ZHACJKMWSA-N |
| XLogP | 4.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|