C21H29NO2S — CID 55456224
N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide (PubChem CID 55456224) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55456224 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
| SMILES | O=C(N(Cc1cccs1)CC1CCCO1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H29NO2S/c23-20(21-10-15-7-16(11-21)9-17(8-15)12-21)22(13-18-3-1-5-24-18)14-19-4-2-6-25-19/h2,4,6,15-18H,1,3,5,7-14H2 |
| InChIKey | IZINOJFIGBFBLG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |