C24H21N3O7 — CID 55392475
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate (PubChem CID 55392475) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate |
|---|---|
| PubChem CID | 55392475 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate |
| SMILES | CC(OC(=O)COc1ccc2oc3c(c2c1)CCCC3)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C24H21N3O7/c1-14(23-25-26-24(34-23)15-6-8-16(9-7-15)27(29)30)32-22(28)13-31-17-10-11-21-19(12-17)18-4-2-3-5-20(18)33-21/h6-12,14H,2-5,13H2,1H3 |
| InChIKey | DQUGQJDZQLRXFY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 130.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|