C23H26ClN3O5 — CID 55398401
2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide (PubChem CID 55398401) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55398401 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)NC(C)c2cc(OC)ccc2OC)C1=O |
| InChI | InChI=1S/C23H26ClN3O5/c1-5-23(15-6-8-16(24)9-7-15)21(29)27(22(30)26-23)13-20(28)25-14(2)18-12-17(31-3)10-11-19(18)32-4/h6-12,14H,5,13H2,1-4H3,(H,25,28)(H,26,30) |
| InChIKey | FUHMZXIDPYOKPR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|