C22H22F3N3O4S — CID 55406954
1-[[3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one (PubChem CID 55406954) has the molecular formula C22H22F3N3O4S and a molecular weight of 481.50 g/mol. Its IUPAC name is 1-[[3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55406954 |
| Molecular Formula | C22H22F3N3O4S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-[[3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1cccc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C22H22F3N3O4S/c23-17-6-7-18(21(25)20(17)24)33(31,32)28-11-9-26(10-12-28)22(30)16-4-1-3-15(13-16)14-27-8-2-5-19(27)29/h1,3-4,6-7,13H,2,5,8-12,14H2 |
| InChIKey | WVSODCHMTFKACR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|