C23H29N3O — CID 55409638
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-phenyl-N-prop-2-enylacetamide (PubChem CID 55409638) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55409638 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CN1CCN(c2cccc(C)c2C)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O/c1-4-13-26(21-10-6-5-7-11-21)23(27)18-24-14-16-25(17-15-24)22-12-8-9-19(2)20(22)3/h4-12H,1,13-18H2,2-3H3 |
| InChIKey | JAEUDROEYSFGCK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|