C28H32N4O3 — CID 55410746
N-benzyl-2-[[2-[4-(2-phenoxyethyl)piperazin-1-yl]acetyl]amino]benzamide (PubChem CID 55410746) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-benzyl-2-[[2-[4-(2-phenoxyethyl)piperazin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[4-(2-phenoxyethyl)piperazin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55410746 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-benzyl-2-[[2-[4-(2-phenoxyethyl)piperazin-1-yl]acetyl]amino]benzamide |
| SMILES | O=C(CN1CCN(CCOc2ccccc2)CC1)Nc1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H32N4O3/c33-27(22-32-17-15-31(16-18-32)19-20-35-24-11-5-2-6-12-24)30-26-14-8-7-13-25(26)28(34)29-21-23-9-3-1-4-10-23/h1-14H,15-22H2,(H,29,34)(H,30,33) |
| InChIKey | JBONQIHUAFEMMO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |