C24H31N3O4 — CID 55411234
N-(butylcarbamoyl)-2-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide (PubChem CID 55411234) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide.
| Compound Name | N-(butylcarbamoyl)-2-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 55411234 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-(butylcarbamoyl)-2-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN1CCc2cc(OC)c(OC)cc2C1c1ccccc1 |
| InChI | InChI=1S/C24H31N3O4/c1-4-5-12-25-24(29)26-22(28)16-27-13-11-18-14-20(30-2)21(31-3)15-19(18)23(27)17-9-7-6-8-10-17/h6-10,14-15,23H,4-5,11-13,16H2,1-3H3,(H2,25,26,28,29) |
| InChIKey | ZBFAUPRLWRWVPS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|