C23H24N4O7 — CID 55415549
2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 55415549) has the molecular formula C23H24N4O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55415549 |
| Molecular Formula | C23H24N4O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccccc1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C23H24N4O7/c28-21(8-3-11-26-19-10-9-15(27(31)32)13-20(19)34-23(26)30)25-18-7-2-1-6-17(18)22(29)24-14-16-5-4-12-33-16/h1-2,6-7,9-10,13,16H,3-5,8,11-12,14H2,(H,24,29)(H,25,28) |
| InChIKey | LOFSSWQNKIGIGX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|