C18H18Cl2N2O6S — CID 55422777
[1-oxo-1-(3-sulfamoylanilino)propan-2-yl] 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 55422777) has the molecular formula C18H18Cl2N2O6S and a molecular weight of 461.32 g/mol. Its IUPAC name is [1-oxo-1-(3-sulfamoylanilino)propan-2-yl] 2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [1-oxo-1-(3-sulfamoylanilino)propan-2-yl] 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 55422777 |
| Molecular Formula | C18H18Cl2N2O6S |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | [1-oxo-1-(3-sulfamoylanilino)propan-2-yl] 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(OC(=O)C(C)Oc1ccc(Cl)cc1Cl)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H18Cl2N2O6S/c1-10(17(23)22-13-4-3-5-14(9-13)29(21,25)26)28-18(24)11(2)27-16-7-6-12(19)8-15(16)20/h3-11H,1-2H3,(H,22,23)(H2,21,25,26) |
| InChIKey | OFEFGGLCRJVXID-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |