C22H18BrN3O2S — CID 55423864
2-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one (PubChem CID 55423864) has the molecular formula C22H18BrN3O2S and a molecular weight of 468.38 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one.
| Compound Name | 2-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 55423864 |
| Molecular Formula | C22H18BrN3O2S |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
| SMILES | COc1ccc(CSc2nc3ccccc3c(=O)n2-c2ccc(C)cn2)cc1Br |
| InChI | InChI=1S/C22H18BrN3O2S/c1-14-7-10-20(24-12-14)26-21(27)16-5-3-4-6-18(16)25-22(26)29-13-15-8-9-19(28-2)17(23)11-15/h3-12H,13H2,1-2H3 |
| InChIKey | HBYOCVHKHJWDCW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |