C11H9NO3S2 — CID 55426094
2-oxopropyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate (PubChem CID 55426094) has the molecular formula C11H9NO3S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-oxopropyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate.
| Compound Name | 2-oxopropyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55426094 |
| Molecular Formula | C11H9NO3S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 2-oxopropyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate |
| SMILES | CC(=O)COC(=O)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C11H9NO3S2/c1-7(13)4-15-11(14)9-6-17-10(12-9)8-2-3-16-5-8/h2-3,5-6H,4H2,1H3 |
| InChIKey | UGUOSYPXQDZUES-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |