About 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate
2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate (PubChem CID 55476103) has the molecular formula C11H8ClNO2S2
and a molecular weight of 285.78 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate.
Analyze 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate (CID 55476103) is 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate is C=C(Cl)COC(=O)c1csc(-c2ccsc2)n1.
What is the InChIKey of 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate?
The InChIKey is QPJFDPRATSSGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO2S2/c1-7(12)4-15-11(14)9-6-17-10(13-9)8-2-3-16-5-8/h2-3,5-6H,1,4H2.
What are the key properties of 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate?
2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate has a molecular weight of 285.78 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroprop-2-enyl 2-thiophen-3-yl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 55476103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).