C18H23NO7S — CID 55427768
(5-methyl-2-oxooxolan-3-yl) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 55427768) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55427768 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)OC3CC(C)OC3=O)C2)cc1 |
| InChI | InChI=1S/C18H23NO7S/c1-12-10-16(18(21)25-12)26-17(20)13-4-3-9-19(11-13)27(22,23)15-7-5-14(24-2)6-8-15/h5-8,12-13,16H,3-4,9-11H2,1-2H3 |
| InChIKey | YATHKBXXDATZCB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |