C25H23FN2O2 — CID 55431981
1-[2-fluoro-6-[[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]phenyl]ethanone (PubChem CID 55431981) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[2-fluoro-6-[[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]phenyl]ethanone.
| Compound Name | 1-[2-fluoro-6-[[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 55431981 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[2-fluoro-6-[[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]phenyl]ethanone |
| SMILES | COc1ccc(C(CNc2cccc(F)c2C(C)=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23FN2O2/c1-16(29)25-22(26)7-5-9-24(25)28-14-20(17-10-12-18(30-2)13-11-17)21-15-27-23-8-4-3-6-19(21)23/h3-13,15,20,27-28H,14H2,1-2H3 |
| InChIKey | TXCUZJNVEBGMON-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |