C23H35N5O3 — CID 55432084
2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide (PubChem CID 55432084) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide.
| Compound Name | 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 55432084 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide |
| SMILES | CCNC(=O)NC(=O)C(c1ccccc1)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C23H35N5O3/c1-2-24-23(31)25-22(30)21(19-10-6-5-7-11-19)28-16-14-26(15-17-28)18-20(29)27-12-8-3-4-9-13-27/h5-7,10-11,21H,2-4,8-9,12-18H2,1H3,(H2,24,25,30,31) |
| InChIKey | AYARNHQGAFIHSQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |