C24H30N4O5 — CID 55543892
2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide (PubChem CID 55543892) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide.
| Compound Name | 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 55543892 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(ethylcarbamoyl)-2-phenylacetamide |
| SMILES | CCNC(=O)NC(=O)C(c1ccccc1)N1CCN(C(=O)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C24H30N4O5/c1-4-25-24(31)26-22(29)21(17-8-6-5-7-9-17)27-12-14-28(15-13-27)23(30)18-10-11-19(32-2)20(16-18)33-3/h5-11,16,21H,4,12-15H2,1-3H3,(H2,25,26,29,31) |
| InChIKey | XXNXBPOIZRUUBB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |