C23H28N4O5S — CID 55436066
3-[4-(diethylsulfamoyl)phenyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)propanamide (PubChem CID 55436066) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 55436066 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NN2C(=O)NC(C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H28N4O5S/c1-4-26(5-2)33(31,32)19-14-11-17(12-15-19)13-16-20(28)25-27-21(29)23(3,24-22(27)30)18-9-7-6-8-10-18/h6-12,14-15H,4-5,13,16H2,1-3H3,(H,24,30)(H,25,28) |
| InChIKey | ICOOAQPOBQLWGC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|