C23H23N5O5S — CID 55438422
(4-imidazol-1-yl-3-nitrophenyl)-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone (PubChem CID 55438422) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is (4-imidazol-1-yl-3-nitrophenyl)-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (4-imidazol-1-yl-3-nitrophenyl)-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 55438422 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (4-imidazol-1-yl-3-nitrophenyl)-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc(-n2ccnc2)c([N+](=O)[O-])c1)N1CCc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H23N5O5S/c29-23(18-4-6-21(22(15-18)28(30)31)25-13-9-24-16-25)27-12-8-17-14-19(5-7-20(17)27)34(32,33)26-10-2-1-3-11-26/h4-7,9,13-16H,1-3,8,10-12H2 |
| InChIKey | HJNQXOMRIQODMD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 118.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|