C22H21N5O3S2 — CID 55439904
2-(2,4-dimethylanilino)-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]acetohydrazide (PubChem CID 55439904) has the molecular formula C22H21N5O3S2 and a molecular weight of 467.58 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]acetohydrazide.
| Compound Name | 2-(2,4-dimethylanilino)-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55439904 |
| Molecular Formula | C22H21N5O3S2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)c(C)c1 |
| InChI | InChI=1S/C22H21N5O3S2/c1-13-5-6-16(14(2)8-13)23-9-18(28)25-26-19(29)10-27-12-24-21-20(22(27)30)15(11-32-21)17-4-3-7-31-17/h3-8,11-12,23H,9-10H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | KRNDPSDLXGHESM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|